C15H21N3O2 — CID 76978571
4-ethyl-N-[2-(N'-hydroxycarbamimidoyl)cyclopentyl]benzamide (PubChem CID 76978571) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-ethyl-N-[2-(N'-hydroxycarbamimidoyl)cyclopentyl]benzamide.
| Compound Name | 4-ethyl-N-[2-(N'-hydroxycarbamimidoyl)cyclopentyl]benzamide |
|---|---|
| PubChem CID | 76978571 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 4-ethyl-N-[2-(N'-hydroxycarbamimidoyl)cyclopentyl]benzamide |
| SMILES | CCc1ccc(C(=O)NC2CCCC2C(N)=NO)cc1 |
| InChI | InChI=1S/C15H21N3O2/c1-2-10-6-8-11(9-7-10)15(19)17-13-5-3-4-12(13)14(16)18-20/h6-9,12-13,20H,2-5H2,1H3,(H2,16,18)(H,17,19) |
| InChIKey | BBZTWEXSIGLWHY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|