C10H19N3O3 — CID 76981294
N'-hydroxy-2-(3-hydroxypyrrolidine-1-carbonyl)-3-methylbutanimidamide (PubChem CID 76981294) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is N'-hydroxy-2-(3-hydroxypyrrolidine-1-carbonyl)-3-methylbutanimidamide.
| Compound Name | N'-hydroxy-2-(3-hydroxypyrrolidine-1-carbonyl)-3-methylbutanimidamide |
|---|---|
| PubChem CID | 76981294 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | N'-hydroxy-2-(3-hydroxypyrrolidine-1-carbonyl)-3-methylbutanimidamide |
| SMILES | CC(C)C(C(=O)N1CCC(O)C1)C(N)=NO |
| InChI | InChI=1S/C10H19N3O3/c1-6(2)8(9(11)12-16)10(15)13-4-3-7(14)5-13/h6-8,14,16H,3-5H2,1-2H3,(H2,11,12) |
| InChIKey | AMHATNKLZVRHCO-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|