C7H13N3O3 — CID 62941218
N'-hydroxy-3-(3-hydroxypyrrolidin-1-yl)-3-oxopropanimidamide (PubChem CID 62941218) has the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. Its IUPAC name is N'-hydroxy-3-(3-hydroxypyrrolidin-1-yl)-3-oxopropanimidamide.
| Compound Name | N'-hydroxy-3-(3-hydroxypyrrolidin-1-yl)-3-oxopropanimidamide |
|---|---|
| PubChem CID | 62941218 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | N'-hydroxy-3-(3-hydroxypyrrolidin-1-yl)-3-oxopropanimidamide |
| SMILES | N/C(CC(=O)N1CCC(O)C1)=N\O |
| InChI | InChI=1S/C7H13N3O3/c8-6(9-13)3-7(12)10-2-1-5(11)4-10/h5,11,13H,1-4H2,(H2,8,9) |
| InChIKey | HNBXCQUVSJAJGK-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|