C12H11ClN2O3 — CID 76984328
3-chloro-4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide (PubChem CID 76984328) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is 3-chloro-4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-chloro-4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 76984328 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 3-chloro-4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(OCc2ccco2)c(Cl)c1 |
| InChI | InChI=1S/C12H11ClN2O3/c13-10-6-8(12(14)15-16)3-4-11(10)18-7-9-2-1-5-17-9/h1-6,16H,7H2,(H2,14,15) |
| InChIKey | TUSHARBSGWVISA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|