About 4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide
4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide (PubChem CID 43188231) has the molecular formula C12H12N2O3
and a molecular weight of 232.24 g/mol. Its IUPAC name is 4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide.
Molecular Properties
| Compound Name | 4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide |
| PubChem CID | 43188231 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(OCc2ccco2)cc1 |
| InChI | InChI=1S/C12H12N2O3/c13-12(14-15)9-3-5-10(6-4-9)17-8-11-2-1-7-16-11/h1-7,15H,8H2,(H2,13,14) |
| InChIKey | CKQXDLWNZPDOBU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 80.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide?
The IUPAC name of 4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide (CID 43188231) is 4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide.
What is the SMILES notation for 4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide?
The canonical SMILES for 4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide is N/C(=N\O)c1ccc(OCc2ccco2)cc1.
What is the InChIKey of 4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide?
The InChIKey is CKQXDLWNZPDOBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3/c13-12(14-15)9-3-5-10(6-4-9)17-8-11-2-1-7-16-11/h1-7,15H,8H2,(H2,13,14).
What are the key properties of 4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide?
4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide has a molecular weight of 232.24 g/mol, XLogP of 1.95, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-2-ylmethoxy)-N'-hydroxybenzenecarboximidamide is sourced from PubChem (CID 43188231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).