C12H11F3N2O4 — CID 76985208
2-[(3-hydroxyimino-1-benzofuran-6-yl)oxy]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 76985208) has the molecular formula C12H11F3N2O4 and a molecular weight of 304.22 g/mol. Its IUPAC name is 2-[(3-hydroxyimino-1-benzofuran-6-yl)oxy]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[(3-hydroxyimino-1-benzofuran-6-yl)oxy]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 76985208 |
| Molecular Formula | C12H11F3N2O4 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-[(3-hydroxyimino-1-benzofuran-6-yl)oxy]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(COc1ccc2c(c1)OCC2=NO)NCC(F)(F)F |
| InChI | InChI=1S/C12H11F3N2O4/c13-12(14,15)6-16-11(18)5-20-7-1-2-8-9(17-19)4-21-10(8)3-7/h1-3,19H,4-6H2,(H,16,18) |
| InChIKey | XUXZFVZCVXJVNI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|