C14H15N3O2S — CID 76985338
3-[5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-enoic acid (PubChem CID 76985338) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 3-[5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76985338 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 3-[5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1csc(CN2CCn3ccnc3C2)c1 |
| InChI | InChI=1S/C14H15N3O2S/c18-14(19)2-1-11-7-12(20-10-11)8-16-5-6-17-4-3-15-13(17)9-16/h1-4,7,10H,5-6,8-9H2,(H,18,19) |
| InChIKey | MAFNGUDURJCLSL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|