C13H19N5O3 — CID 76986788
2-[3-(dimethylamino)pyrrolidin-1-yl]-N'-hydroxy-5-nitrobenzenecarboximidamide (PubChem CID 76986788) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-[3-(dimethylamino)pyrrolidin-1-yl]-N'-hydroxy-5-nitrobenzenecarboximidamide.
| Compound Name | 2-[3-(dimethylamino)pyrrolidin-1-yl]-N'-hydroxy-5-nitrobenzenecarboximidamide |
|---|---|
| PubChem CID | 76986788 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2-[3-(dimethylamino)pyrrolidin-1-yl]-N'-hydroxy-5-nitrobenzenecarboximidamide |
| SMILES | CN(C)C1CCN(c2ccc([N+](=O)[O-])cc2C(N)=NO)C1 |
| InChI | InChI=1S/C13H19N5O3/c1-16(2)10-5-6-17(8-10)12-4-3-9(18(20)21)7-11(12)13(14)15-19/h3-4,7,10,19H,5-6,8H2,1-2H3,(H2,14,15) |
| InChIKey | LCXHHHJQVFALOL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|