C7H17N3O3S — CID 76988192
N'-hydroxy-2-[methyl(3-methylsulfonylpropyl)amino]ethanimidamide (PubChem CID 76988192) has the molecular formula C7H17N3O3S and a molecular weight of 223.30 g/mol. Its IUPAC name is N'-hydroxy-2-[methyl(3-methylsulfonylpropyl)amino]ethanimidamide.
| Compound Name | N'-hydroxy-2-[methyl(3-methylsulfonylpropyl)amino]ethanimidamide |
|---|---|
| PubChem CID | 76988192 |
| Molecular Formula | C7H17N3O3S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | N'-hydroxy-2-[methyl(3-methylsulfonylpropyl)amino]ethanimidamide |
| SMILES | CN(CCCS(C)(=O)=O)CC(N)=NO |
| InChI | InChI=1S/C7H17N3O3S/c1-10(6-7(8)9-11)4-3-5-14(2,12)13/h11H,3-6H2,1-2H3,(H2,8,9) |
| InChIKey | AMXLVIHRFUATHA-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|