C13H21N3O5 — CID 76992145
2,3-dimethyl-4-oxo-4-[[1-oxo-1-(propylamino)propan-2-yl]carbamoylamino]but-2-enoic acid (PubChem CID 76992145) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2,3-dimethyl-4-oxo-4-[[1-oxo-1-(propylamino)propan-2-yl]carbamoylamino]but-2-enoic acid.
| Compound Name | 2,3-dimethyl-4-oxo-4-[[1-oxo-1-(propylamino)propan-2-yl]carbamoylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 76992145 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2,3-dimethyl-4-oxo-4-[[1-oxo-1-(propylamino)propan-2-yl]carbamoylamino]but-2-enoic acid |
| SMILES | CCCNC(=O)C(C)NC(=O)NC(=O)C(C)=C(C)C(=O)O |
| InChI | InChI=1S/C13H21N3O5/c1-5-6-14-11(18)9(4)15-13(21)16-10(17)7(2)8(3)12(19)20/h9H,5-6H2,1-4H3,(H,14,18)(H,19,20)(H2,15,16,17,21) |
| InChIKey | GAZNJCGRBURNAP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|