C12H16N4O4 — CID 76992391
2,3-dimethyl-4-oxo-4-(2-pyrazol-1-ylethylcarbamoylamino)but-2-enoic acid (PubChem CID 76992391) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2,3-dimethyl-4-oxo-4-(2-pyrazol-1-ylethylcarbamoylamino)but-2-enoic acid.
| Compound Name | 2,3-dimethyl-4-oxo-4-(2-pyrazol-1-ylethylcarbamoylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 76992391 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2,3-dimethyl-4-oxo-4-(2-pyrazol-1-ylethylcarbamoylamino)but-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NC(=O)NCCn1cccn1 |
| InChI | InChI=1S/C12H16N4O4/c1-8(9(2)11(18)19)10(17)15-12(20)13-5-7-16-6-3-4-14-16/h3-4,6H,5,7H2,1-2H3,(H,18,19)(H2,13,15,17,20) |
| InChIKey | NXZJZBYENUBHTD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|