C16H29NO3 — CID 76993180
4-(dipentylamino)-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 76993180) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is 4-(dipentylamino)-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-(dipentylamino)-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76993180 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 4-(dipentylamino)-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CCCCCN(CCCCC)C(=O)C(C)=C(C)C(=O)O |
| InChI | InChI=1S/C16H29NO3/c1-5-7-9-11-17(12-10-8-6-2)15(18)13(3)14(4)16(19)20/h5-12H2,1-4H3,(H,19,20) |
| InChIKey | LGPMBJPCULLUDX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|