C10H24N4O2 — CID 76994019
3-[2-(dimethylamino)ethyl-(2-methoxyethyl)amino]-N'-hydroxypropanimidamide (PubChem CID 76994019) has the molecular formula C10H24N4O2 and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl-(2-methoxyethyl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[2-(dimethylamino)ethyl-(2-methoxyethyl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 76994019 |
| Molecular Formula | C10H24N4O2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl-(2-methoxyethyl)amino]-N'-hydroxypropanimidamide |
| SMILES | COCCN(CCC(N)=NO)CCN(C)C |
| InChI | InChI=1S/C10H24N4O2/c1-13(2)6-7-14(8-9-16-3)5-4-10(11)12-15/h15H,4-9H2,1-3H3,(H2,11,12) |
| InChIKey | ZHQZBLWNEVUSNR-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|