C15H17ClN2O2 — CID 76995491
4-[3-(4-chlorophenyl)prop-2-enoyl]-3,3-dimethylpiperazin-2-one (PubChem CID 76995491) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)prop-2-enoyl]-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-[3-(4-chlorophenyl)prop-2-enoyl]-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 76995491 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-[3-(4-chlorophenyl)prop-2-enoyl]-3,3-dimethylpiperazin-2-one |
| SMILES | CC1(C)C(=O)NCCN1C(=O)C=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClN2O2/c1-15(2)14(20)17-9-10-18(15)13(19)8-5-11-3-6-12(16)7-4-11/h3-8H,9-10H2,1-2H3,(H,17,20) |
| InChIKey | SNWKPCNQJRBGKZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|