C10H16N2O2 — CID 63606699
4-[(E)-but-2-enoyl]-3,3-dimethylpiperazin-2-one (PubChem CID 63606699) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-[(E)-but-2-enoyl]-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-[(E)-but-2-enoyl]-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 63606699 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 4-[(E)-but-2-enoyl]-3,3-dimethylpiperazin-2-one |
| SMILES | C/C=C/C(=O)N1CCNC(=O)C1(C)C |
| InChI | InChI=1S/C10H16N2O2/c1-4-5-8(13)12-7-6-11-9(14)10(12,2)3/h4-5H,6-7H2,1-3H3,(H,11,14)/b5-4+ |
| InChIKey | SWVNVRCAIFIHEW-SNAWJCMRSA-N |
| XLogP | 0.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|