C13H17F2NO — CID 76997203
5-[4-(difluoromethoxy)phenyl]-3-methylpent-2-en-1-amine (PubChem CID 76997203) has the molecular formula C13H17F2NO and a molecular weight of 241.28 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)phenyl]-3-methylpent-2-en-1-amine.
| Compound Name | 5-[4-(difluoromethoxy)phenyl]-3-methylpent-2-en-1-amine |
|---|---|
| PubChem CID | 76997203 |
| Molecular Formula | C13H17F2NO |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 5-[4-(difluoromethoxy)phenyl]-3-methylpent-2-en-1-amine |
| SMILES | CC(=CCN)CCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H17F2NO/c1-10(8-9-16)2-3-11-4-6-12(7-5-11)17-13(14)15/h4-8,13H,2-3,9,16H2,1H3 |
| InChIKey | LMGSUIWJBFNIMY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|