C8H11N3O2 — CID 76998595
2-[2-(methylamino)ethyl]-5-methylidene-1H-pyrimidine-4,6-dione (PubChem CID 76998595) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-[2-(methylamino)ethyl]-5-methylidene-1H-pyrimidine-4,6-dione.
| Compound Name | 2-[2-(methylamino)ethyl]-5-methylidene-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 76998595 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2-[2-(methylamino)ethyl]-5-methylidene-1H-pyrimidine-4,6-dione |
| SMILES | C=C1C(=O)N=C(CCNC)NC1=O |
| InChI | InChI=1S/C8H11N3O2/c1-5-7(12)10-6(3-4-9-2)11-8(5)13/h9H,1,3-4H2,2H3,(H,10,11,12,13) |
| InChIKey | RMYSWTRITRMVGP-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|