C6H6N2O2 — CID 78175853
2-methyl-5-methylidene-1H-pyrimidine-4,6-dione (PubChem CID 78175853) has the molecular formula C6H6N2O2 and a molecular weight of 138.13 g/mol. Its IUPAC name is 2-methyl-5-methylidene-1H-pyrimidine-4,6-dione.
| Compound Name | 2-methyl-5-methylidene-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 78175853 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 2-methyl-5-methylidene-1H-pyrimidine-4,6-dione |
| SMILES | C=C1C(=O)N=C(C)NC1=O |
| InChI | InChI=1S/C6H6N2O2/c1-3-5(9)7-4(2)8-6(3)10/h1H2,2H3,(H,7,8,9,10) |
| InChIKey | AWWGJBITIIVZGJ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|