C6H4N2O3 — CID 176525740
2-methyl-5-(oxomethylidene)-1H-pyrimidine-4,6-dione (PubChem CID 176525740) has the molecular formula C6H4N2O3 and a molecular weight of 152.11 g/mol. Its IUPAC name is 2-methyl-5-(oxomethylidene)-1H-pyrimidine-4,6-dione.
| Compound Name | 2-methyl-5-(oxomethylidene)-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 176525740 |
| Molecular Formula | C6H4N2O3 |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 2-methyl-5-(oxomethylidene)-1H-pyrimidine-4,6-dione |
| SMILES | CC1=NC(=O)C(=C=O)C(=O)N1 |
| InChI | InChI=1S/C6H4N2O3/c1-3-7-5(10)4(2-9)6(11)8-3/h1H3,(H,7,8,10,11) |
| InChIKey | JJSAMOLBQIWOAR-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|