C14H19NO2Si2 — CID 57412887
3,4-bis(2-trimethylsilylethynyl)pyrrole-2,5-dione (PubChem CID 57412887) has the molecular formula C14H19NO2Si2 and a molecular weight of 289.48 g/mol. Its IUPAC name is 3,4-bis(2-trimethylsilylethynyl)pyrrole-2,5-dione.
| Compound Name | 3,4-bis(2-trimethylsilylethynyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 57412887 |
| Molecular Formula | C14H19NO2Si2 |
| Molecular Weight | 289.48 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 3,4-bis(2-trimethylsilylethynyl)pyrrole-2,5-dione |
| SMILES | C[Si](C)(C)C#CC1=C(C#C[Si](C)(C)C)C(=O)NC1=O |
| InChI | InChI=1S/C14H19NO2Si2/c1-18(2,3)9-7-11-12(8-10-19(4,5)6)14(17)15-13(11)16/h1-6H3,(H,15,16,17) |
| InChIKey | SLMUWJBDWWVQGF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|