C9H13N3OSi — CID 156692417
6-amino-5-(2-trimethylsilylethynyl)-1H-pyrimidin-2-one (PubChem CID 156692417) has the molecular formula C9H13N3OSi and a molecular weight of 207.31 g/mol. Its IUPAC name is 6-amino-5-(2-trimethylsilylethynyl)-1H-pyrimidin-2-one.
| Compound Name | 6-amino-5-(2-trimethylsilylethynyl)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 156692417 |
| Molecular Formula | C9H13N3OSi |
| Molecular Weight | 207.31 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 6-amino-5-(2-trimethylsilylethynyl)-1H-pyrimidin-2-one |
| SMILES | C[Si](C)(C)C#Cc1cnc(=O)[nH]c1N |
| InChI | InChI=1S/C9H13N3OSi/c1-14(2,3)5-4-7-6-11-9(13)12-8(7)10/h6H,1-3H3,(H3,10,11,12,13) |
| InChIKey | QRYBTHURFHWVAS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|