About 6-amino-5-bromo-1H-pyrimidin-2-one;6-amino-5-methyl-1H-pyrimidin-2-one
6-amino-5-bromo-1H-pyrimidin-2-one;6-amino-5-methyl-1H-pyrimidin-2-one (PubChem CID 158467141) has the molecular formula C9H11BrN6O2
and a molecular weight of 315.13 g/mol. Its IUPAC name is 6-amino-5-bromo-1H-pyrimidin-2-one;6-amino-5-methyl-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 6-amino-5-bromo-1H-pyrimidin-2-one;6-amino-5-methyl-1H-pyrimidin-2-one |
| PubChem CID | 158467141 |
| Molecular Formula | C9H11BrN6O2 |
| Molecular Weight | 315.13 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 6-amino-5-bromo-1H-pyrimidin-2-one;6-amino-5-methyl-1H-pyrimidin-2-one |
| SMILES | Cc1cnc(=O)[nH]c1N.Nc1[nH]c(=O)ncc1Br |
| InChI | InChI=1S/C5H7N3O.C4H4BrN3O/c1-3-2-7-5(9)8-4(3)6;5-2-1-7-4(9)8-3(2)6/h2H,1H3,(H3,6,7,8,9);1H,(H3,6,7,8,9) |
| InChIKey | HFWXTJUGYOAOBP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 143.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.13 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-amino-5-bromo-1H-pyrimidin-2-one;6-amino-5-methyl-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-bromo-1H-pyrimidin-2-one;6-amino-5-methyl-1H-pyrimidin-2-one?
The IUPAC name of 6-amino-5-bromo-1H-pyrimidin-2-one;6-amino-5-methyl-1H-pyrimidin-2-one (CID 158467141) is 6-amino-5-bromo-1H-pyrimidin-2-one;6-amino-5-methyl-1H-pyrimidin-2-one.
What is the SMILES notation for 6-amino-5-bromo-1H-pyrimidin-2-one;6-amino-5-methyl-1H-pyrimidin-2-one?
The canonical SMILES for 6-amino-5-bromo-1H-pyrimidin-2-one;6-amino-5-methyl-1H-pyrimidin-2-one is Cc1cnc(=O)[nH]c1N.Nc1[nH]c(=O)ncc1Br.
What is the InChIKey of 6-amino-5-bromo-1H-pyrimidin-2-one;6-amino-5-methyl-1H-pyrimidin-2-one?
The InChIKey is HFWXTJUGYOAOBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O.C4H4BrN3O/c1-3-2-7-5(9)8-4(3)6;5-2-1-7-4(9)8-3(2)6/h2H,1H3,(H3,6,7,8,9);1H,(H3,6,7,8,9).
What are the key properties of 6-amino-5-bromo-1H-pyrimidin-2-one;6-amino-5-methyl-1H-pyrimidin-2-one?
6-amino-5-bromo-1H-pyrimidin-2-one;6-amino-5-methyl-1H-pyrimidin-2-one has a molecular weight of 315.13 g/mol, XLogP of -0.22, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-bromo-1H-pyrimidin-2-one;6-amino-5-methyl-1H-pyrimidin-2-one is sourced from PubChem (CID 158467141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).