C7H8N4O — CID 176913214
6-amino-5-(prop-1-ynylamino)-1H-pyrimidin-2-one (PubChem CID 176913214) has the molecular formula C7H8N4O and a molecular weight of 164.17 g/mol. Its IUPAC name is 6-amino-5-(prop-1-ynylamino)-1H-pyrimidin-2-one.
| Compound Name | 6-amino-5-(prop-1-ynylamino)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 176913214 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 6-amino-5-(prop-1-ynylamino)-1H-pyrimidin-2-one |
| SMILES | CC#CNc1cnc(=O)[nH]c1N |
| InChI | InChI=1S/C7H8N4O/c1-2-3-9-5-4-10-7(12)11-6(5)8/h4,9H,1H3,(H3,8,10,11,12) |
| InChIKey | JHFCXGDVZZEQAI-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|