C13H11BrN2O2S — CID 77007128
3-bromo-N-[2-(N-hydroxy-C-methylcarbonimidoyl)phenyl]thiophene-2-carboxamide (PubChem CID 77007128) has the molecular formula C13H11BrN2O2S and a molecular weight of 339.21 g/mol. Its IUPAC name is 3-bromo-N-[2-(N-hydroxy-C-methylcarbonimidoyl)phenyl]thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-[2-(N-hydroxy-C-methylcarbonimidoyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 77007128 |
| Molecular Formula | C13H11BrN2O2S |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 3-bromo-N-[2-(N-hydroxy-C-methylcarbonimidoyl)phenyl]thiophene-2-carboxamide |
| SMILES | CC(=NO)c1ccccc1NC(=O)c1sccc1Br |
| InChI | InChI=1S/C13H11BrN2O2S/c1-8(16-18)9-4-2-3-5-11(9)15-13(17)12-10(14)6-7-19-12/h2-7,18H,1H3,(H,15,17) |
| InChIKey | PXPUVGYCXXFCBC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|