C24H21ClN6O3 — CID 77014382
4-[[(1R)-1-[3-[(2-chloro-6-methoxypyridine-3-carbonyl)amino]phenyl]ethyl]amino]quinazoline-8-carboxamide (PubChem CID 77014382) has the molecular formula C24H21ClN6O3 and a molecular weight of 476.92 g/mol. Its IUPAC name is 4-[[(1R)-1-[3-[(2-chloro-6-methoxypyridine-3-carbonyl)amino]phenyl]ethyl]amino]quinazoline-8-carboxamide.
| Compound Name | 4-[[(1R)-1-[3-[(2-chloro-6-methoxypyridine-3-carbonyl)amino]phenyl]ethyl]amino]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 77014382 |
| Molecular Formula | C24H21ClN6O3 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 4-[[(1R)-1-[3-[(2-chloro-6-methoxypyridine-3-carbonyl)amino]phenyl]ethyl]amino]quinazoline-8-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2cccc([C@@H](C)Nc3ncnc4c(C(N)=O)cccc34)c2)c(Cl)n1 |
| InChI | InChI=1S/C24H21ClN6O3/c1-13(29-23-17-8-4-7-16(22(26)32)20(17)27-12-28-23)14-5-3-6-15(11-14)30-24(33)18-9-10-19(34-2)31-21(18)25/h3-13H,1-2H3,(H2,26,32)(H,30,33)(H,27,28,29)/t13-/m1/s1 |
| InChIKey | JSUHYJIHHCDQHG-CYBMUJFWSA-N |
| XLogP | 4.21 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|