C9H14N4OS — CID 77017400
N'-hydroxy-3-pyrimidin-4-ylsulfanylpentanimidamide (PubChem CID 77017400) has the molecular formula C9H14N4OS and a molecular weight of 226.31 g/mol. Its IUPAC name is N'-hydroxy-3-pyrimidin-4-ylsulfanylpentanimidamide.
| Compound Name | N'-hydroxy-3-pyrimidin-4-ylsulfanylpentanimidamide |
|---|---|
| PubChem CID | 77017400 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N'-hydroxy-3-pyrimidin-4-ylsulfanylpentanimidamide |
| SMILES | CCC(CC(N)=NO)Sc1ccncn1 |
| InChI | InChI=1S/C9H14N4OS/c1-2-7(5-8(10)13-14)15-9-3-4-11-6-12-9/h3-4,6-7,14H,2,5H2,1H3,(H2,10,13) |
| InChIKey | DKLALIPUADQGMQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|