C22H19ClO4S — CID 7701952
[(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate (PubChem CID 7701952) has the molecular formula C22H19ClO4S and a molecular weight of 414.91 g/mol. Its IUPAC name is [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate.
| Compound Name | [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate |
|---|---|
| PubChem CID | 7701952 |
| Molecular Formula | C22H19ClO4S |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate |
| SMILES | COc1ccc(C(=O)[C@H](C)OC(=O)CSc2cccc3cccc(Cl)c23)cc1 |
| InChI | InChI=1S/C22H19ClO4S/c1-14(22(25)16-9-11-17(26-2)12-10-16)27-20(24)13-28-19-8-4-6-15-5-3-7-18(23)21(15)19/h3-12,14H,13H2,1-2H3/t14-/m0/s1 |
| InChIKey | QQFSGLDTZMKTGL-AWEZNQCLSA-N |
| XLogP | 5.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |