C17H18ClNO3S — CID 9417530
[(2R)-1-(dimethylamino)-1-oxopropan-2-yl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate (PubChem CID 9417530) has the molecular formula C17H18ClNO3S and a molecular weight of 351.86 g/mol. Its IUPAC name is [(2R)-1-(dimethylamino)-1-oxopropan-2-yl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate.
| Compound Name | [(2R)-1-(dimethylamino)-1-oxopropan-2-yl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate |
|---|---|
| PubChem CID | 9417530 |
| Molecular Formula | C17H18ClNO3S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | [(2R)-1-(dimethylamino)-1-oxopropan-2-yl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate |
| SMILES | C[C@@H](OC(=O)CSc1cccc2cccc(Cl)c12)C(=O)N(C)C |
| InChI | InChI=1S/C17H18ClNO3S/c1-11(17(21)19(2)3)22-15(20)10-23-14-9-5-7-12-6-4-8-13(18)16(12)14/h4-9,11H,10H2,1-3H3/t11-/m1/s1 |
| InChIKey | YZTRYGBSVYQRKV-LLVKDONJSA-N |
| XLogP | 3.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |