C19H21ClN2O4S — CID 7985395
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate (PubChem CID 7985395) has the molecular formula C19H21ClN2O4S and a molecular weight of 408.91 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate |
|---|---|
| PubChem CID | 7985395 |
| Molecular Formula | C19H21ClN2O4S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate |
| SMILES | CC(C)CNC(=O)NC(=O)COC(=O)CSc1cccc2cccc(Cl)c12 |
| InChI | InChI=1S/C19H21ClN2O4S/c1-12(2)9-21-19(25)22-16(23)10-26-17(24)11-27-15-8-4-6-13-5-3-7-14(20)18(13)15/h3-8,12H,9-11H2,1-2H3,(H2,21,22,23,25) |
| InChIKey | KSMUDUKLFZRBOW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |