C24H23ClN2O4S — CID 35563806
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate (PubChem CID 35563806) has the molecular formula C24H23ClN2O4S and a molecular weight of 470.98 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate |
|---|---|
| PubChem CID | 35563806 |
| Molecular Formula | C24H23ClN2O4S |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate |
| SMILES | O=C(COC(=O)CSc1cccc2cccc(Cl)c12)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H23ClN2O4S/c25-20-5-1-3-17-4-2-6-21(24(17)20)32-16-23(29)31-15-22(28)26-18-7-9-19(10-8-18)27-11-13-30-14-12-27/h1-10H,11-16H2,(H,26,28) |
| InChIKey | TWFAJZWMHANKLV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|