C19H20ClNO4S — CID 7985398
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate (PubChem CID 7985398) has the molecular formula C19H20ClNO4S and a molecular weight of 393.89 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate |
|---|---|
| PubChem CID | 7985398 |
| Molecular Formula | C19H20ClNO4S |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(8-chloronaphthalen-1-yl)sulfanylacetate |
| SMILES | O=C(COC(=O)CSc1cccc2cccc(Cl)c12)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C19H20ClNO4S/c20-15-7-1-4-13-5-2-8-16(19(13)15)26-12-18(23)25-11-17(22)21-10-14-6-3-9-24-14/h1-2,4-5,7-8,14H,3,6,9-12H2,(H,21,22)/t14-/m1/s1 |
| InChIKey | LSCONXVQAOVGHU-CQSZACIVSA-N |
| XLogP | 3.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |