C16H20ClNO2 — CID 77021449
3-[2-chloro-6-(2-methylazepan-1-yl)phenyl]prop-2-enoic acid (PubChem CID 77021449) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is 3-[2-chloro-6-(2-methylazepan-1-yl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[2-chloro-6-(2-methylazepan-1-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77021449 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-[2-chloro-6-(2-methylazepan-1-yl)phenyl]prop-2-enoic acid |
| SMILES | CC1CCCCCN1c1cccc(Cl)c1C=CC(=O)O |
| InChI | InChI=1S/C16H20ClNO2/c1-12-6-3-2-4-11-18(12)15-8-5-7-14(17)13(15)9-10-16(19)20/h5,7-10,12H,2-4,6,11H2,1H3,(H,19,20) |
| InChIKey | LYLUNMVKQSEFGM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|