C15H18ClNO2 — CID 79184454
3-[2-chloro-6-(3,4-dimethylpyrrolidin-1-yl)phenyl]prop-2-enoic acid (PubChem CID 79184454) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 3-[2-chloro-6-(3,4-dimethylpyrrolidin-1-yl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[2-chloro-6-(3,4-dimethylpyrrolidin-1-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79184454 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-[2-chloro-6-(3,4-dimethylpyrrolidin-1-yl)phenyl]prop-2-enoic acid |
| SMILES | CC1CN(c2cccc(Cl)c2C=CC(=O)O)CC1C |
| InChI | InChI=1S/C15H18ClNO2/c1-10-8-17(9-11(10)2)14-5-3-4-13(16)12(14)6-7-15(18)19/h3-7,10-11H,8-9H2,1-2H3,(H,18,19) |
| InChIKey | LLGVEGMMFNZSQH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|