C11H21N3O2S — CID 77021679
N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]thiolane-2-carboxamide (PubChem CID 77021679) has the molecular formula C11H21N3O2S and a molecular weight of 259.37 g/mol. Its IUPAC name is N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]thiolane-2-carboxamide.
| Compound Name | N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]thiolane-2-carboxamide |
|---|---|
| PubChem CID | 77021679 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]thiolane-2-carboxamide |
| SMILES | CCC(CC)(NC(=O)C1CCCS1)C(N)=NO |
| InChI | InChI=1S/C11H21N3O2S/c1-3-11(4-2,10(12)14-16)13-9(15)8-6-5-7-17-8/h8,16H,3-7H2,1-2H3,(H2,12,14)(H,13,15) |
| InChIKey | NCSVBVOQFZGCSV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|