C14H14ClN3O — CID 77022306
3-(2-chlorophenyl)-N-[2-(1H-imidazol-5-yl)ethyl]prop-2-enamide (PubChem CID 77022306) has the molecular formula C14H14ClN3O and a molecular weight of 275.74 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[2-(1H-imidazol-5-yl)ethyl]prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-[2-(1H-imidazol-5-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 77022306 |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[2-(1H-imidazol-5-yl)ethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1Cl)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C14H14ClN3O/c15-13-4-2-1-3-11(13)5-6-14(19)17-8-7-12-9-16-10-18-12/h1-6,9-10H,7-8H2,(H,16,18)(H,17,19) |
| InChIKey | LCYJFXIPGGEEEC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|