C11H18N4O — CID 77030286
N'-hydroxy-2-methyl-3-(2-pyridin-4-ylethylamino)propanimidamide (PubChem CID 77030286) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-3-(2-pyridin-4-ylethylamino)propanimidamide.
| Compound Name | N'-hydroxy-2-methyl-3-(2-pyridin-4-ylethylamino)propanimidamide |
|---|---|
| PubChem CID | 77030286 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N'-hydroxy-2-methyl-3-(2-pyridin-4-ylethylamino)propanimidamide |
| SMILES | CC(CNCCc1ccncc1)C(N)=NO |
| InChI | InChI=1S/C11H18N4O/c1-9(11(12)15-16)8-14-7-4-10-2-5-13-6-3-10/h2-3,5-6,9,14,16H,4,7-8H2,1H3,(H2,12,15) |
| InChIKey | ILSPLKQBEFHORL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|