C8H15N3O — CID 77027860
3-(but-3-ynylamino)-N'-hydroxy-2-methylpropanimidamide (PubChem CID 77027860) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 3-(but-3-ynylamino)-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-(but-3-ynylamino)-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 77027860 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 3-(but-3-ynylamino)-N'-hydroxy-2-methylpropanimidamide |
| SMILES | C#CCCNCC(C)C(N)=NO |
| InChI | InChI=1S/C8H15N3O/c1-3-4-5-10-6-7(2)8(9)11-12/h1,7,10,12H,4-6H2,2H3,(H2,9,11) |
| InChIKey | NHGIRRYOPKFXDC-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|