C12H27N3O — CID 107815448
3-(2-ethylhexylamino)-N'-hydroxy-2-methylpropanimidamide (PubChem CID 107815448) has the molecular formula C12H27N3O and a molecular weight of 229.37 g/mol. Its IUPAC name is 3-(2-ethylhexylamino)-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-(2-ethylhexylamino)-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 107815448 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | 3-(2-ethylhexylamino)-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CCCCC(CC)CNCC(C)C(N)=NO |
| InChI | InChI=1S/C12H27N3O/c1-4-6-7-11(5-2)9-14-8-10(3)12(13)15-16/h10-11,14,16H,4-9H2,1-3H3,(H2,13,15) |
| InChIKey | CGESJQIZXADVTE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|