C10H19N5O — CID 77030553
N'-hydroxy-2-(1-imidazol-1-ylpropan-2-ylamino)butanimidamide (PubChem CID 77030553) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is N'-hydroxy-2-(1-imidazol-1-ylpropan-2-ylamino)butanimidamide.
| Compound Name | N'-hydroxy-2-(1-imidazol-1-ylpropan-2-ylamino)butanimidamide |
|---|---|
| PubChem CID | 77030553 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | N'-hydroxy-2-(1-imidazol-1-ylpropan-2-ylamino)butanimidamide |
| SMILES | CCC(NC(C)Cn1ccnc1)C(N)=NO |
| InChI | InChI=1S/C10H19N5O/c1-3-9(10(11)14-16)13-8(2)6-15-5-4-12-7-15/h4-5,7-9,13,16H,3,6H2,1-2H3,(H2,11,14) |
| InChIKey | OEHGYMDFGNCLTK-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|