C9H14N4O2 — CID 77032863
N'-hydroxy-2-[(2-methoxy-4-pyridinyl)methylamino]ethanimidamide (PubChem CID 77032863) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is N'-hydroxy-2-[(2-methoxy-4-pyridinyl)methylamino]ethanimidamide.
| Compound Name | N'-hydroxy-2-[(2-methoxy-4-pyridinyl)methylamino]ethanimidamide |
|---|---|
| PubChem CID | 77032863 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | N'-hydroxy-2-[(2-methoxy-4-pyridinyl)methylamino]ethanimidamide |
| SMILES | COc1cc(CNCC(N)=NO)ccn1 |
| InChI | InChI=1S/C9H14N4O2/c1-15-9-4-7(2-3-12-9)5-11-6-8(10)13-14/h2-4,11,14H,5-6H2,1H3,(H2,10,13) |
| InChIKey | KKEBETUZDFMMBR-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|