C12H20N4O3S — CID 77036641
N'-hydroxy-5-(2-pyridin-4-ylethylsulfonylamino)pentanimidamide (PubChem CID 77036641) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is N'-hydroxy-5-(2-pyridin-4-ylethylsulfonylamino)pentanimidamide.
| Compound Name | N'-hydroxy-5-(2-pyridin-4-ylethylsulfonylamino)pentanimidamide |
|---|---|
| PubChem CID | 77036641 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N'-hydroxy-5-(2-pyridin-4-ylethylsulfonylamino)pentanimidamide |
| SMILES | NC(CCCCNS(=O)(=O)CCc1ccncc1)=NO |
| InChI | InChI=1S/C12H20N4O3S/c13-12(16-17)3-1-2-7-15-20(18,19)10-6-11-4-8-14-9-5-11/h4-5,8-9,15,17H,1-3,6-7,10H2,(H2,13,16) |
| InChIKey | WDJIGWFCFCSBTJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|