C6H12N4O2 — CID 77038333
(2-amino-1-cyclopropyl-2-hydroxyiminoethyl)urea (PubChem CID 77038333) has the molecular formula C6H12N4O2 and a molecular weight of 172.19 g/mol. Its IUPAC name is (2-amino-1-cyclopropyl-2-hydroxyiminoethyl)urea.
| Compound Name | (2-amino-1-cyclopropyl-2-hydroxyiminoethyl)urea |
|---|---|
| PubChem CID | 77038333 |
| Molecular Formula | C6H12N4O2 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (2-amino-1-cyclopropyl-2-hydroxyiminoethyl)urea |
| SMILES | NC(=O)NC(C(N)=NO)C1CC1 |
| InChI | InChI=1S/C6H12N4O2/c7-5(10-12)4(3-1-2-3)9-6(8)11/h3-4,12H,1-2H2,(H2,7,10)(H3,8,9,11) |
| InChIKey | KLZSZMVTBMZZBE-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|