C7H13N3O2 — CID 77038392
N-(2-amino-1-cyclopropyl-2-hydroxyiminoethyl)acetamide (PubChem CID 77038392) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropyl-2-hydroxyiminoethyl)acetamide.
| Compound Name | N-(2-amino-1-cyclopropyl-2-hydroxyiminoethyl)acetamide |
|---|---|
| PubChem CID | 77038392 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | N-(2-amino-1-cyclopropyl-2-hydroxyiminoethyl)acetamide |
| SMILES | CC(=O)NC(C(N)=NO)C1CC1 |
| InChI | InChI=1S/C7H13N3O2/c1-4(11)9-6(5-2-3-5)7(8)10-12/h5-6,12H,2-3H2,1H3,(H2,8,10)(H,9,11) |
| InChIKey | PZVPDJGAIXWOAG-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|