C11H20N4O3 — CID 22840786
(2R)-2-acetamido-2-[4-(diaminomethylideneamino)cyclohexyl]acetic acid (PubChem CID 22840786) has the molecular formula C11H20N4O3 and a molecular weight of 256.31 g/mol. Its IUPAC name is (2R)-2-acetamido-2-[4-(diaminomethylideneamino)cyclohexyl]acetic acid.
| Compound Name | (2R)-2-acetamido-2-[4-(diaminomethylideneamino)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 22840786 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (2R)-2-acetamido-2-[4-(diaminomethylideneamino)cyclohexyl]acetic acid |
| SMILES | CC(=O)N[C@@H](C(=O)O)C1CCC(N=C(N)N)CC1 |
| InChI | InChI=1S/C11H20N4O3/c1-6(16)14-9(10(17)18)7-2-4-8(5-3-7)15-11(12)13/h7-9H,2-5H2,1H3,(H,14,16)(H,17,18)(H4,12,13,15)/t7?,8?,9-/m1/s1 |
| InChIKey | SBNYILRFZWPGGM-AMDVSUOASA-N |
| XLogP | -0.59 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|