C12H23N5O2 — CID 153036166
2-acetamido-2-[(1R,2S)-2-(diaminomethylideneamino)cyclopentyl]-N,N-dimethylacetamide (PubChem CID 153036166) has the molecular formula C12H23N5O2 and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-acetamido-2-[(1R,2S)-2-(diaminomethylideneamino)cyclopentyl]-N,N-dimethylacetamide.
| Compound Name | 2-acetamido-2-[(1R,2S)-2-(diaminomethylideneamino)cyclopentyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 153036166 |
| Molecular Formula | C12H23N5O2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 2-acetamido-2-[(1R,2S)-2-(diaminomethylideneamino)cyclopentyl]-N,N-dimethylacetamide |
| SMILES | CC(=O)NC(C(=O)N(C)C)[C@H]1CCC[C@@H]1N=C(N)N |
| InChI | InChI=1S/C12H23N5O2/c1-7(18)15-10(11(19)17(2)3)8-5-4-6-9(8)16-12(13)14/h8-10H,4-6H2,1-3H3,(H,15,18)(H4,13,14,16)/t8-,9-,10?/m0/s1 |
| InChIKey | VEUANUQWTJOPDG-XMCUXHSSSA-N |
| XLogP | -0.98 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|