C15H27N5O4 — CID 5278585
trans-(3R,4S)-3-[1-acetamido-2-(butan-2-ylamino)-2-oxoethyl]-4-(diaminomethylideneamino)cyclopentane-1-carboxylic acid (PubChem CID 5278585) has the molecular formula C15H27N5O4 and a molecular weight of 341.41 g/mol. Its IUPAC name is trans-(3R,4S)-3-[1-acetamido-2-(butan-2-ylamino)-2-oxoethyl]-4-(diaminomethylideneamino)cyclopentane-1-carboxylic acid.
| Compound Name | trans-(3R,4S)-3-[1-acetamido-2-(butan-2-ylamino)-2-oxoethyl]-4-(diaminomethylideneamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 5278585 |
| Molecular Formula | C15H27N5O4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | trans-(3R,4S)-3-[1-acetamido-2-(butan-2-ylamino)-2-oxoethyl]-4-(diaminomethylideneamino)cyclopentane-1-carboxylic acid |
| SMILES | CCC(C)NC(=O)C(NC(C)=O)[C@H]1CC(C(=O)O)C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C15H27N5O4/c1-4-7(2)18-13(22)12(19-8(3)21)10-5-9(14(23)24)6-11(10)20-15(16)17/h7,9-12H,4-6H2,1-3H3,(H,18,22)(H,19,21)(H,23,24)(H4,16,17,20)/t7?,9?,10-,11-,12?/m0/s1 |
| InChIKey | IZTLSDCUYAZFJH-YESITCRYSA-N |
| XLogP | -0.84 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|