C9H19N5O2 — CID 70080616
2-[[4-(diaminomethylideneamino)piperidin-1-yl]amino]propanoic acid (PubChem CID 70080616) has the molecular formula C9H19N5O2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-[[4-(diaminomethylideneamino)piperidin-1-yl]amino]propanoic acid.
| Compound Name | 2-[[4-(diaminomethylideneamino)piperidin-1-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 70080616 |
| Molecular Formula | C9H19N5O2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 2-[[4-(diaminomethylideneamino)piperidin-1-yl]amino]propanoic acid |
| SMILES | CC(NN1CCC(N=C(N)N)CC1)C(=O)O |
| InChI | InChI=1S/C9H19N5O2/c1-6(8(15)16)13-14-4-2-7(3-5-14)12-9(10)11/h6-7,13H,2-5H2,1H3,(H,15,16)(H4,10,11,12) |
| InChIKey | LQIHYOANZAVWOF-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 116.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|