C12H17N5O2 — CID 77041745
N'-hydroxy-1-(5-methylpyrazine-2-carbonyl)piperidine-3-carboximidamide (PubChem CID 77041745) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is N'-hydroxy-1-(5-methylpyrazine-2-carbonyl)piperidine-3-carboximidamide.
| Compound Name | N'-hydroxy-1-(5-methylpyrazine-2-carbonyl)piperidine-3-carboximidamide |
|---|---|
| PubChem CID | 77041745 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | N'-hydroxy-1-(5-methylpyrazine-2-carbonyl)piperidine-3-carboximidamide |
| SMILES | Cc1cnc(C(=O)N2CCCC(C(N)=NO)C2)cn1 |
| InChI | InChI=1S/C12H17N5O2/c1-8-5-15-10(6-14-8)12(18)17-4-2-3-9(7-17)11(13)16-19/h5-6,9,19H,2-4,7H2,1H3,(H2,13,16) |
| InChIKey | SVTNRCULMBBXBQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|