C26H27N3O4 — CID 77050707
N-[(4R,4aS,7aR)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]pyridine-2-carboxamide (PubChem CID 77050707) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[(4R,4aS,7aR)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]pyridine-2-carboxamide.
| Compound Name | N-[(4R,4aS,7aR)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 77050707 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-[(4R,4aS,7aR)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]pyridine-2-carboxamide |
| SMILES | O=C(N[C@@]12CCC(=O)[C@@H]3Oc4c(O)ccc5c4C31CCN(CC1CC1)[C@@H]2C5)c1ccccn1 |
| InChI | InChI=1S/C26H27N3O4/c30-18-7-6-16-13-20-26(28-24(32)17-3-1-2-11-27-17)9-8-19(31)23-25(26,21(16)22(18)33-23)10-12-29(20)14-15-4-5-15/h1-3,6-7,11,15,20,23,30H,4-5,8-10,12-14H2,(H,28,32)/t20-,23+,25?,26-/m1/s1 |
| InChIKey | BFWDKCMZDSXLMZ-LOIPOHDRSA-N |
| XLogP | 2.36 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |