C17H16Cl2N2O2 — CID 7705437
(2S)-N-(2,4-dichlorophenyl)-2-[(Z)-(4-methylphenyl)methylideneamino]oxypropanamide (PubChem CID 7705437) has the molecular formula C17H16Cl2N2O2 and a molecular weight of 351.23 g/mol. Its IUPAC name is (2S)-N-(2,4-dichlorophenyl)-2-[(Z)-(4-methylphenyl)methylideneamino]oxypropanamide.
| Compound Name | (2S)-N-(2,4-dichlorophenyl)-2-[(Z)-(4-methylphenyl)methylideneamino]oxypropanamide |
|---|---|
| PubChem CID | 7705437 |
| Molecular Formula | C17H16Cl2N2O2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (2S)-N-(2,4-dichlorophenyl)-2-[(Z)-(4-methylphenyl)methylideneamino]oxypropanamide |
| SMILES | Cc1ccc(/C=N\O[C@@H](C)C(=O)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H16Cl2N2O2/c1-11-3-5-13(6-4-11)10-20-23-12(2)17(22)21-16-8-7-14(18)9-15(16)19/h3-10,12H,1-2H3,(H,21,22)/b20-10-/t12-/m0/s1 |
| InChIKey | VBTQRBXTPLSYMS-XGTDKWECSA-N |
| XLogP | 4.68 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|